C22H21N3O5 — CID 2304584
(3Z,5E)-3,5-bis[(3-nitrophenyl)methylidene]-1-propylpiperidin-4-one (PubChem CID 2304584) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(3-nitrophenyl)methylidene]-1-propylpiperidin-4-one.
| Compound Name | (3Z,5E)-3,5-bis[(3-nitrophenyl)methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 2304584 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (3Z,5E)-3,5-bis[(3-nitrophenyl)methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1C/C(=C/c2cccc([N+](=O)[O-])c2)C(=O)/C(=C/c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H21N3O5/c1-2-9-23-14-18(10-16-5-3-7-20(12-16)24(27)28)22(26)19(15-23)11-17-6-4-8-21(13-17)25(29)30/h3-8,10-13H,2,9,14-15H2,1H3/b18-10-,19-11+ |
| InChIKey | BYMKRWHYWQDRHG-OMYAATJGSA-N |
| XLogP | 4.26 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|