About 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid)
3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) (PubChem CID 23046621) has the molecular formula C22H40O9
and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid).
Molecular Properties
| Compound Name | 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) |
| PubChem CID | 23046621 |
| Molecular Formula | C22H40O9 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.OCCCCCCC(CO)CCO |
| InChI | InChI=1S/C10H22O3.3C4H6O2/c11-7-4-2-1-3-5-10(9-13)6-8-12;3*1-3(2)4(5)6/h10-13H,1-9H2;3*1H2,2H3,(H,5,6) |
| InChIKey | IFLGQHVRQYIKQI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid)?
The IUPAC name of 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) (CID 23046621) is 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid).
What is the SMILES notation for 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid)?
The canonical SMILES for 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) is C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.OCCCCCCC(CO)CCO.
What is the InChIKey of 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid)?
The InChIKey is IFLGQHVRQYIKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3.3C4H6O2/c11-7-4-2-1-3-5-10(9-13)6-8-12;3*1-3(2)4(5)6/h10-13H,1-9H2;3*1H2,2H3,(H,5,6).
What are the key properties of 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid)?
3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) has a molecular weight of 448.55 g/mol, XLogP of 2.86, 12 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)nonane-1,9-diol;tris(2-methylprop-2-enoic acid) is sourced from PubChem (CID 23046621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).