About N,N-diethyl-4-(1,3-oxazol-2-yl)aniline
N,N-diethyl-4-(1,3-oxazol-2-yl)aniline (PubChem CID 23047077) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is N,N-diethyl-4-(1,3-oxazol-2-yl)aniline.
Molecular Properties
| Compound Name | N,N-diethyl-4-(1,3-oxazol-2-yl)aniline |
| PubChem CID | 23047077 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N,N-diethyl-4-(1,3-oxazol-2-yl)aniline |
| SMILES | CCN(CC)c1ccc(-c2ncco2)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-3-15(4-2)12-7-5-11(6-8-12)13-14-9-10-16-13/h5-10H,3-4H2,1-2H3 |
| InChIKey | QDYXDRDJOREZHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-4-(1,3-oxazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-(1,3-oxazol-2-yl)aniline?
The IUPAC name of N,N-diethyl-4-(1,3-oxazol-2-yl)aniline (CID 23047077) is N,N-diethyl-4-(1,3-oxazol-2-yl)aniline.
What is the SMILES notation for N,N-diethyl-4-(1,3-oxazol-2-yl)aniline?
The canonical SMILES for N,N-diethyl-4-(1,3-oxazol-2-yl)aniline is CCN(CC)c1ccc(-c2ncco2)cc1.
What is the InChIKey of N,N-diethyl-4-(1,3-oxazol-2-yl)aniline?
The InChIKey is QDYXDRDJOREZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-3-15(4-2)12-7-5-11(6-8-12)13-14-9-10-16-13/h5-10H,3-4H2,1-2H3.
What are the key properties of N,N-diethyl-4-(1,3-oxazol-2-yl)aniline?
N,N-diethyl-4-(1,3-oxazol-2-yl)aniline has a molecular weight of 216.28 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-(1,3-oxazol-2-yl)aniline is sourced from PubChem (CID 23047077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).