About 1-oxo-2,6-diphenylthian-4-ol
1-oxo-2,6-diphenylthian-4-ol (PubChem CID 23047099) has the molecular formula C17H18O2S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-oxo-2,6-diphenylthian-4-ol.
Molecular Properties
| Compound Name | 1-oxo-2,6-diphenylthian-4-ol |
| PubChem CID | 23047099 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-oxo-2,6-diphenylthian-4-ol |
| SMILES | O=S1C(c2ccccc2)CC(O)CC1c1ccccc1 |
| InChI | InChI=1S/C17H18O2S/c18-15-11-16(13-7-3-1-4-8-13)20(19)17(12-15)14-9-5-2-6-10-14/h1-10,15-18H,11-12H2 |
| InChIKey | CZIDAYSPLJWXJP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxo-2,6-diphenylthian-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-2,6-diphenylthian-4-ol?
The IUPAC name of 1-oxo-2,6-diphenylthian-4-ol (CID 23047099) is 1-oxo-2,6-diphenylthian-4-ol.
What is the SMILES notation for 1-oxo-2,6-diphenylthian-4-ol?
The canonical SMILES for 1-oxo-2,6-diphenylthian-4-ol is O=S1C(c2ccccc2)CC(O)CC1c1ccccc1.
What is the InChIKey of 1-oxo-2,6-diphenylthian-4-ol?
The InChIKey is CZIDAYSPLJWXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2S/c18-15-11-16(13-7-3-1-4-8-13)20(19)17(12-15)14-9-5-2-6-10-14/h1-10,15-18H,11-12H2.
What are the key properties of 1-oxo-2,6-diphenylthian-4-ol?
1-oxo-2,6-diphenylthian-4-ol has a molecular weight of 286.40 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-2,6-diphenylthian-4-ol is sourced from PubChem (CID 23047099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).