C46H74O7S4 — CID 23047219
2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]-2-[2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]oxan-2-yl]oxyoxane (PubChem CID 23047219) has the molecular formula C46H74O7S4 and a molecular weight of 867.36 g/mol. Its IUPAC name is 2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]-2-[2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]oxan-2-yl]oxyoxane.
| Compound Name | 2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]-2-[2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]oxan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 23047219 |
| Molecular Formula | C46H74O7S4 |
| Molecular Weight | 867.36 g/mol |
| Exact Mass | 866.43 |
| IUPAC Name | 2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]-2-[2-[8-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]octyl]oxan-2-yl]oxyoxane |
| SMILES | COCOc1c(SC)cc(CCCCCCCCC2(OC3(CCCCCCCCc4cc(SC)c(OCOC)c(SC)c4)CCCCO3)CCCCO2)cc1SC |
| InChI | InChI=1S/C46H74O7S4/c1-47-35-49-43-39(54-3)31-37(32-40(43)55-4)23-15-11-7-9-13-17-25-45(27-19-21-29-51-45)53-46(28-20-22-30-52-46)26-18-14-10-8-12-16-24-38-33-41(56-5)44(50-36-48-2)42(34-38)57-6/h31-34H,7-30,35-36H2,1-6H3 |
| InChIKey | GWFWTMWKMQRCOE-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.36 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|