About 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile
2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile (PubChem CID 23047349) has the molecular formula C22H25Cl2N3O
and a molecular weight of 418.37 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile |
| PubChem CID | 23047349 |
| Molecular Formula | C22H25Cl2N3O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile |
| SMILES | N#CC(CCCCC1CNCCO1)(Cc1cccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N3O/c23-20-7-6-18(12-21(20)24)22(16-25,13-17-4-3-9-26-14-17)8-2-1-5-19-15-27-10-11-28-19/h3-4,6-7,9,12,14,19,27H,1-2,5,8,10-11,13,15H2 |
| InChIKey | KEXUMSATBNGONG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile?
The IUPAC name of 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile (CID 23047349) is 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile?
The canonical SMILES for 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile is N#CC(CCCCC1CNCCO1)(Cc1cccnc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile?
The InChIKey is KEXUMSATBNGONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25Cl2N3O/c23-20-7-6-18(12-21(20)24)22(16-25,13-17-4-3-9-26-14-17)8-2-1-5-19-15-27-10-11-28-19/h3-4,6-7,9,12,14,19,27H,1-2,5,8,10-11,13,15H2.
What are the key properties of 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile?
2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile has a molecular weight of 418.37 g/mol, XLogP of 4.94, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-6-morpholin-2-yl-2-(pyridin-3-ylmethyl)hexanenitrile is sourced from PubChem (CID 23047349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).