About 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole
3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole (PubChem CID 23047368) has the molecular formula C23H19N3O3
and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole |
| PubChem CID | 23047368 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole |
| SMILES | COCc1c(-c2ccon2)ncc2[nH]c3cccc(OCc4ccccc4)c3c12 |
| InChI | InChI=1S/C23H19N3O3/c1-27-14-16-21-19(12-24-23(16)18-10-11-29-26-18)25-17-8-5-9-20(22(17)21)28-13-15-6-3-2-4-7-15/h2-12,25H,13-14H2,1H3 |
| InChIKey | SPJBMSLUXZDWKV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole?
The IUPAC name of 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole (CID 23047368) is 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole.
What is the SMILES notation for 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole?
The canonical SMILES for 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole is COCc1c(-c2ccon2)ncc2[nH]c3cccc(OCc4ccccc4)c3c12.
What is the InChIKey of 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole?
The InChIKey is SPJBMSLUXZDWKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O3/c1-27-14-16-21-19(12-24-23(16)18-10-11-29-26-18)25-17-8-5-9-20(22(17)21)28-13-15-6-3-2-4-7-15/h2-12,25H,13-14H2,1H3.
What are the key properties of 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole?
3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole has a molecular weight of 385.42 g/mol, XLogP of 5.10, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(methoxymethyl)-5-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole is sourced from PubChem (CID 23047368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).