C23H20FNO — CID 23047402
(E)-3-[3-ethyl-1-(4-fluorophenyl)pyrrolo[2,1-a]isoquinolin-2-yl]prop-1-en-1-ol (PubChem CID 23047402) has the molecular formula C23H20FNO and a molecular weight of 345.42 g/mol. Its IUPAC name is (E)-3-[3-ethyl-1-(4-fluorophenyl)pyrrolo[2,1-a]isoquinolin-2-yl]prop-1-en-1-ol.
| Compound Name | (E)-3-[3-ethyl-1-(4-fluorophenyl)pyrrolo[2,1-a]isoquinolin-2-yl]prop-1-en-1-ol |
|---|---|
| PubChem CID | 23047402 |
| Molecular Formula | C23H20FNO |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (E)-3-[3-ethyl-1-(4-fluorophenyl)pyrrolo[2,1-a]isoquinolin-2-yl]prop-1-en-1-ol |
| SMILES | CCc1c(C/C=C/O)c(-c2ccc(F)cc2)c2c3ccccc3ccn12 |
| InChI | InChI=1S/C23H20FNO/c1-2-21-20(8-5-15-26)22(17-9-11-18(24)12-10-17)23-19-7-4-3-6-16(19)13-14-25(21)23/h3-7,9-15,26H,2,8H2,1H3/b15-5+ |
| InChIKey | JFAIUBSNLFMNQE-PJQLUOCWSA-N |
| XLogP | 6.08 |
| TPSA | 24.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|