About N-(1,2-dihydropyridin-5-yl)acetamide
N-(1,2-dihydropyridin-5-yl)acetamide (PubChem CID 23047672) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is N-(1,2-dihydropyridin-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(1,2-dihydropyridin-5-yl)acetamide |
| PubChem CID | 23047672 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | N-(1,2-dihydropyridin-5-yl)acetamide |
| SMILES | CC(=O)NC1=CNCC=C1 |
| InChI | InChI=1S/C7H10N2O/c1-6(10)9-7-3-2-4-8-5-7/h2-3,5,8H,4H2,1H3,(H,9,10) |
| InChIKey | RTKLCCCXSSHJAA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1,2-dihydropyridin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-dihydropyridin-5-yl)acetamide?
The IUPAC name of N-(1,2-dihydropyridin-5-yl)acetamide (CID 23047672) is N-(1,2-dihydropyridin-5-yl)acetamide.
What is the SMILES notation for N-(1,2-dihydropyridin-5-yl)acetamide?
The canonical SMILES for N-(1,2-dihydropyridin-5-yl)acetamide is CC(=O)NC1=CNCC=C1.
What is the InChIKey of N-(1,2-dihydropyridin-5-yl)acetamide?
The InChIKey is RTKLCCCXSSHJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-6(10)9-7-3-2-4-8-5-7/h2-3,5,8H,4H2,1H3,(H,9,10).
What are the key properties of N-(1,2-dihydropyridin-5-yl)acetamide?
N-(1,2-dihydropyridin-5-yl)acetamide has a molecular weight of 138.17 g/mol, XLogP of 0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-dihydropyridin-5-yl)acetamide is sourced from PubChem (CID 23047672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).