About 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane
2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane (PubChem CID 23047688) has the molecular formula C16H17ClN2O5S
and a molecular weight of 384.84 g/mol. Its IUPAC name is 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane.
Molecular Properties
| Compound Name | 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane |
| PubChem CID | 23047688 |
| Molecular Formula | C16H17ClN2O5S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane |
| SMILES | COC.NS(=O)(=O)c1cc(C2(O)NC(=O)c3ccccc32)ccc1Cl |
| InChI | InChI=1S/C14H11ClN2O4S.C2H6O/c15-11-6-5-8(7-12(11)22(16,20)21)14(19)10-4-2-1-3-9(10)13(18)17-14;1-3-2/h1-7,19H,(H,17,18)(H2,16,20,21);1-2H3 |
| InChIKey | AXIWUDRCWCOGLF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane?
The IUPAC name of 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane (CID 23047688) is 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane.
What is the SMILES notation for 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane?
The canonical SMILES for 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane is COC.NS(=O)(=O)c1cc(C2(O)NC(=O)c3ccccc32)ccc1Cl.
What is the InChIKey of 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane?
The InChIKey is AXIWUDRCWCOGLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2O4S.C2H6O/c15-11-6-5-8(7-12(11)22(16,20)21)14(19)10-4-2-1-3-9(10)13(18)17-14;1-3-2/h1-7,19H,(H,17,18)(H2,16,20,21);1-2H3.
What are the key properties of 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane?
2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane has a molecular weight of 384.84 g/mol, XLogP of 1.19, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide;methoxymethane is sourced from PubChem (CID 23047688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).