About (4-nitrosoanilino) benzoate
(4-nitrosoanilino) benzoate (PubChem CID 2304812) has the molecular formula C13H10N2O3
and a molecular weight of 242.23 g/mol. Its IUPAC name is (4-nitrosoanilino) benzoate.
Molecular Properties
| Compound Name | (4-nitrosoanilino) benzoate |
| PubChem CID | 2304812 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (4-nitrosoanilino) benzoate |
| SMILES | O=Nc1ccc(NOC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10N2O3/c16-13(10-4-2-1-3-5-10)18-15-12-8-6-11(14-17)7-9-12/h1-9,15H |
| InChIKey | JDYAFHQNENWHAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrosoanilino) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrosoanilino) benzoate?
The IUPAC name of (4-nitrosoanilino) benzoate (CID 2304812) is (4-nitrosoanilino) benzoate.
What is the SMILES notation for (4-nitrosoanilino) benzoate?
The canonical SMILES for (4-nitrosoanilino) benzoate is O=Nc1ccc(NOC(=O)c2ccccc2)cc1.
What is the InChIKey of (4-nitrosoanilino) benzoate?
The InChIKey is JDYAFHQNENWHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3/c16-13(10-4-2-1-3-5-10)18-15-12-8-6-11(14-17)7-9-12/h1-9,15H.
What are the key properties of (4-nitrosoanilino) benzoate?
(4-nitrosoanilino) benzoate has a molecular weight of 242.23 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrosoanilino) benzoate is sourced from PubChem (CID 2304812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).