About bis(triethylazanium);sulfate
bis(triethylazanium);sulfate (PubChem CID 23048603) has the molecular formula C12H32N2O4S
and a molecular weight of 300.46 g/mol. Its IUPAC name is bis(triethylazanium);sulfate.
Molecular Properties
| Compound Name | bis(triethylazanium);sulfate |
| PubChem CID | 23048603 |
| Molecular Formula | C12H32N2O4S |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | bis(triethylazanium);sulfate |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C6H15N.H2O4S/c2*1-4-7(5-2)6-3;1-5(2,3)4/h2*4-6H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | NKNFUMKGJYKPCT-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(triethylazanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(triethylazanium);sulfate?
The IUPAC name of bis(triethylazanium);sulfate (CID 23048603) is bis(triethylazanium);sulfate.
What is the SMILES notation for bis(triethylazanium);sulfate?
The canonical SMILES for bis(triethylazanium);sulfate is CC[NH+](CC)CC.CC[NH+](CC)CC.O=S(=O)([O-])[O-].
What is the InChIKey of bis(triethylazanium);sulfate?
The InChIKey is NKNFUMKGJYKPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15N.H2O4S/c2*1-4-7(5-2)6-3;1-5(2,3)4/h2*4-6H2,1-3H3;(H2,1,2,3,4).
What are the key properties of bis(triethylazanium);sulfate?
bis(triethylazanium);sulfate has a molecular weight of 300.46 g/mol, XLogP of -1.48, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(triethylazanium);sulfate is sourced from PubChem (CID 23048603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).