About 2-ethyl-2,6-diisocyanatohexanoic acid
2-ethyl-2,6-diisocyanatohexanoic acid (PubChem CID 23048630) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-ethyl-2,6-diisocyanatohexanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-2,6-diisocyanatohexanoic acid |
| PubChem CID | 23048630 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-ethyl-2,6-diisocyanatohexanoic acid |
| SMILES | CCC(CCCCN=C=O)(N=C=O)C(=O)O |
| InChI | InChI=1S/C10H14N2O4/c1-2-10(9(15)16,12-8-14)5-3-4-6-11-7-13/h2-6H2,1H3,(H,15,16) |
| InChIKey | NDOMPQUIFWLKSC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2,6-diisocyanatohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,6-diisocyanatohexanoic acid?
The IUPAC name of 2-ethyl-2,6-diisocyanatohexanoic acid (CID 23048630) is 2-ethyl-2,6-diisocyanatohexanoic acid.
What is the SMILES notation for 2-ethyl-2,6-diisocyanatohexanoic acid?
The canonical SMILES for 2-ethyl-2,6-diisocyanatohexanoic acid is CCC(CCCCN=C=O)(N=C=O)C(=O)O.
What is the InChIKey of 2-ethyl-2,6-diisocyanatohexanoic acid?
The InChIKey is NDOMPQUIFWLKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-2-10(9(15)16,12-8-14)5-3-4-6-11-7-13/h2-6H2,1H3,(H,15,16).
What are the key properties of 2-ethyl-2,6-diisocyanatohexanoic acid?
2-ethyl-2,6-diisocyanatohexanoic acid has a molecular weight of 226.23 g/mol, XLogP of 1.06, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,6-diisocyanatohexanoic acid is sourced from PubChem (CID 23048630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).