C23H33N7O2 — CID 23048781
2-[3-[3-(diethylamino)propyl]piperidine-1-carbonyl]-6-methyl-2,5,6,9,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-8-one (PubChem CID 23048781) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[3-[3-(diethylamino)propyl]piperidine-1-carbonyl]-6-methyl-2,5,6,9,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-8-one.
| Compound Name | 2-[3-[3-(diethylamino)propyl]piperidine-1-carbonyl]-6-methyl-2,5,6,9,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-8-one |
|---|---|
| PubChem CID | 23048781 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-[3-[3-(diethylamino)propyl]piperidine-1-carbonyl]-6-methyl-2,5,6,9,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-8-one |
| SMILES | CCN(CC)CCCC1CCCN(C(=O)N2c3cnn(C)c3C(=O)Nc3cccnc32)C1 |
| InChI | InChI=1S/C23H33N7O2/c1-4-28(5-2)13-7-9-17-10-8-14-29(16-17)23(32)30-19-15-25-27(3)20(19)22(31)26-18-11-6-12-24-21(18)30/h6,11-12,15,17H,4-5,7-10,13-14,16H2,1-3H3,(H,26,31) |
| InChIKey | PZHYPXJCSYZJOW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |