C10H13NO2 — CID 23049078
2,2-dimethyl-3,4-dihydropyrano[3,2-b]pyridin-4-ol (PubChem CID 23049078) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydropyrano[3,2-b]pyridin-4-ol.
| Compound Name | 2,2-dimethyl-3,4-dihydropyrano[3,2-b]pyridin-4-ol |
|---|---|
| PubChem CID | 23049078 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydropyrano[3,2-b]pyridin-4-ol |
| SMILES | CC1(C)CC(O)c2ncccc2O1 |
| InChI | InChI=1S/C10H13NO2/c1-10(2)6-7(12)9-8(13-10)4-3-5-11-9/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | PHSFPJMQXBDRKX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |