C15H12N4O6 — CID 23049114
1-(2,2-dimethylpyrano[3,2-b]pyridin-4-yl)-3,5-dinitropyridin-2-one (PubChem CID 23049114) has the molecular formula C15H12N4O6 and a molecular weight of 344.28 g/mol. Its IUPAC name is 1-(2,2-dimethylpyrano[3,2-b]pyridin-4-yl)-3,5-dinitropyridin-2-one.
| Compound Name | 1-(2,2-dimethylpyrano[3,2-b]pyridin-4-yl)-3,5-dinitropyridin-2-one |
|---|---|
| PubChem CID | 23049114 |
| Molecular Formula | C15H12N4O6 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-(2,2-dimethylpyrano[3,2-b]pyridin-4-yl)-3,5-dinitropyridin-2-one |
| SMILES | CC1(C)C=C(n2cc([N+](=O)[O-])cc([N+](=O)[O-])c2=O)c2ncccc2O1 |
| InChI | InChI=1S/C15H12N4O6/c1-15(2)7-11(13-12(25-15)4-3-5-16-13)17-8-9(18(21)22)6-10(14(17)20)19(23)24/h3-8H,1-2H3 |
| InChIKey | HRHNUINYDNRPPK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|