C9H12F8 — CID 23049362
1,1,1,2,2,3,3,4-octafluoro-4,5,5-trimethylhexane (PubChem CID 23049362) has the molecular formula C9H12F8 and a molecular weight of 272.18 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4-octafluoro-4,5,5-trimethylhexane.
| Compound Name | 1,1,1,2,2,3,3,4-octafluoro-4,5,5-trimethylhexane |
|---|---|
| PubChem CID | 23049362 |
| Molecular Formula | C9H12F8 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1,1,1,2,2,3,3,4-octafluoro-4,5,5-trimethylhexane |
| SMILES | CC(C)(C)C(C)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F8/c1-5(2,3)6(4,10)7(11,12)8(13,14)9(15,16)17/h1-4H3 |
| InChIKey | HHCBKUJECMDPMF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|