C5H4Cl4N4 — CID 23049398
2,4-diamino-2,3,3,4-tetrachloropentanedinitrile (PubChem CID 23049398) has the molecular formula C5H4Cl4N4 and a molecular weight of 261.93 g/mol. Its IUPAC name is 2,4-diamino-2,3,3,4-tetrachloropentanedinitrile.
| Compound Name | 2,4-diamino-2,3,3,4-tetrachloropentanedinitrile |
|---|---|
| PubChem CID | 23049398 |
| Molecular Formula | C5H4Cl4N4 |
| Molecular Weight | 261.93 g/mol |
| Exact Mass | 259.92 |
| IUPAC Name | 2,4-diamino-2,3,3,4-tetrachloropentanedinitrile |
| SMILES | N#CC(N)(Cl)C(Cl)(Cl)C(N)(Cl)C#N |
| InChI | InChI=1S/C5H4Cl4N4/c6-3(12,1-10)5(8,9)4(7,13)2-11/h12-13H2 |
| InChIKey | KOZJAUOMVSVHBV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.93 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|