C10H7F6N2O2- — CID 23049422
2-[2,6-diamino-3-(trifluoromethyl)phenyl]-3,3,3-trifluoropropanoate (PubChem CID 23049422) has the molecular formula C10H7F6N2O2- and a molecular weight of 301.17 g/mol. Its IUPAC name is 2-[2,6-diamino-3-(trifluoromethyl)phenyl]-3,3,3-trifluoropropanoate.
| Compound Name | 2-[2,6-diamino-3-(trifluoromethyl)phenyl]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 23049422 |
| Molecular Formula | C10H7F6N2O2- |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-[2,6-diamino-3-(trifluoromethyl)phenyl]-3,3,3-trifluoropropanoate |
| SMILES | Nc1ccc(C(F)(F)F)c(N)c1C(C(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2O2/c11-9(12,13)3-1-2-4(17)5(7(3)18)6(8(19)20)10(14,15)16/h1-2,6H,17-18H2,(H,19,20)/p-1 |
| InChIKey | VEVNPKWDQFJGDF-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|