About 3,4-dipentoxythiophene
3,4-dipentoxythiophene (PubChem CID 23049601) has the molecular formula C14H24O2S
and a molecular weight of 256.41 g/mol. Its IUPAC name is 3,4-dipentoxythiophene.
Molecular Properties
| Compound Name | 3,4-dipentoxythiophene |
| PubChem CID | 23049601 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3,4-dipentoxythiophene |
| SMILES | CCCCCOc1cscc1OCCCCC |
| InChI | InChI=1S/C14H24O2S/c1-3-5-7-9-15-13-11-17-12-14(13)16-10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | VEURLWNWUPRJET-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dipentoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dipentoxythiophene?
The IUPAC name of 3,4-dipentoxythiophene (CID 23049601) is 3,4-dipentoxythiophene.
What is the SMILES notation for 3,4-dipentoxythiophene?
The canonical SMILES for 3,4-dipentoxythiophene is CCCCCOc1cscc1OCCCCC.
What is the InChIKey of 3,4-dipentoxythiophene?
The InChIKey is VEURLWNWUPRJET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2S/c1-3-5-7-9-15-13-11-17-12-14(13)16-10-8-6-4-2/h11-12H,3-10H2,1-2H3.
What are the key properties of 3,4-dipentoxythiophene?
3,4-dipentoxythiophene has a molecular weight of 256.41 g/mol, XLogP of 4.89, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dipentoxythiophene is sourced from PubChem (CID 23049601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).