About tert-butyl cyclohexa-1,3-diene-1-carboxylate
tert-butyl cyclohexa-1,3-diene-1-carboxylate (PubChem CID 23049697) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is tert-butyl cyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl cyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 23049697 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | tert-butyl cyclohexa-1,3-diene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C11H16O2/c1-11(2,3)13-10(12)9-7-5-4-6-8-9/h4-5,7H,6,8H2,1-3H3 |
| InChIKey | AEACSOKFIFFIBQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl cyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl cyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of tert-butyl cyclohexa-1,3-diene-1-carboxylate (CID 23049697) is tert-butyl cyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for tert-butyl cyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for tert-butyl cyclohexa-1,3-diene-1-carboxylate is CC(C)(C)OC(=O)C1=CC=CCC1.
What is the InChIKey of tert-butyl cyclohexa-1,3-diene-1-carboxylate?
The InChIKey is AEACSOKFIFFIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-11(2,3)13-10(12)9-7-5-4-6-8-9/h4-5,7H,6,8H2,1-3H3.
What are the key properties of tert-butyl cyclohexa-1,3-diene-1-carboxylate?
tert-butyl cyclohexa-1,3-diene-1-carboxylate has a molecular weight of 180.25 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl cyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 23049697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).