About cyclohexylazanium;2-sulfanylethanesulfonate
cyclohexylazanium;2-sulfanylethanesulfonate (PubChem CID 23049873) has the molecular formula C8H19NO3S2
and a molecular weight of 241.38 g/mol. Its IUPAC name is cyclohexylazanium;2-sulfanylethanesulfonate.
Molecular Properties
| Compound Name | cyclohexylazanium;2-sulfanylethanesulfonate |
| PubChem CID | 23049873 |
| Molecular Formula | C8H19NO3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | cyclohexylazanium;2-sulfanylethanesulfonate |
| SMILES | O=S(=O)([O-])CCS.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C6H13N.C2H6O3S2/c7-6-4-2-1-3-5-6;3-7(4,5)2-1-6/h6H,1-5,7H2;6H,1-2H2,(H,3,4,5) |
| InChIKey | AJEODFLNPFNMOH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylazanium;2-sulfanylethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylazanium;2-sulfanylethanesulfonate?
The IUPAC name of cyclohexylazanium;2-sulfanylethanesulfonate (CID 23049873) is cyclohexylazanium;2-sulfanylethanesulfonate.
What is the SMILES notation for cyclohexylazanium;2-sulfanylethanesulfonate?
The canonical SMILES for cyclohexylazanium;2-sulfanylethanesulfonate is O=S(=O)([O-])CCS.[NH3+]C1CCCCC1.
What is the InChIKey of cyclohexylazanium;2-sulfanylethanesulfonate?
The InChIKey is AJEODFLNPFNMOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2H6O3S2/c7-6-4-2-1-3-5-6;3-7(4,5)2-1-6/h6H,1-5,7H2;6H,1-2H2,(H,3,4,5).
What are the key properties of cyclohexylazanium;2-sulfanylethanesulfonate?
cyclohexylazanium;2-sulfanylethanesulfonate has a molecular weight of 241.38 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylazanium;2-sulfanylethanesulfonate is sourced from PubChem (CID 23049873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).