About 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid
4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid (PubChem CID 23049985) has the molecular formula C13H11FN2O2
and a molecular weight of 246.24 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid |
| PubChem CID | 23049985 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(C)c(C(=O)O)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C13H11FN2O2/c1-7-11(13(17)18)12(16-8(2)15-7)9-3-5-10(14)6-4-9/h3-6H,1-2H3,(H,17,18) |
| InChIKey | BNLVTFDYQKGPGU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid?
The IUPAC name of 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid (CID 23049985) is 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid?
The canonical SMILES for 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid is Cc1nc(C)c(C(=O)O)c(-c2ccc(F)cc2)n1.
What is the InChIKey of 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid?
The InChIKey is BNLVTFDYQKGPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FN2O2/c1-7-11(13(17)18)12(16-8(2)15-7)9-3-5-10(14)6-4-9/h3-6H,1-2H3,(H,17,18).
What are the key properties of 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid?
4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid has a molecular weight of 246.24 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-2,6-dimethylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 23049985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).