C15H16F3N3O3S — CID 23050793
N-[2-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,7-hexahydroindazole-2-carboxamide (PubChem CID 23050793) has the molecular formula C15H16F3N3O3S and a molecular weight of 375.37 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,7-hexahydroindazole-2-carboxamide.
| Compound Name | N-[2-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,7-hexahydroindazole-2-carboxamide |
|---|---|
| PubChem CID | 23050793 |
| Molecular Formula | C15H16F3N3O3S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[2-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,7-hexahydroindazole-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1C(F)(F)F)N1CC2CCCCC2=N1 |
| InChI | InChI=1S/C15H16F3N3O3S/c16-15(17,18)11-6-2-4-8-13(11)25(23,24)20-14(22)21-9-10-5-1-3-7-12(10)19-21/h2,4,6,8,10H,1,3,5,7,9H2,(H,20,22) |
| InChIKey | XNLMBCNZCWIJHL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |