C19H36N2O4 — CID 23051014
3-aminohexanedioic acid;4-(cyclohexylmethyl)cyclohexan-1-amine (PubChem CID 23051014) has the molecular formula C19H36N2O4 and a molecular weight of 356.51 g/mol. Its IUPAC name is 3-aminohexanedioic acid;4-(cyclohexylmethyl)cyclohexan-1-amine.
| Compound Name | 3-aminohexanedioic acid;4-(cyclohexylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 23051014 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 3-aminohexanedioic acid;4-(cyclohexylmethyl)cyclohexan-1-amine |
| SMILES | NC(CCC(=O)O)CC(=O)O.NC1CCC(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C13H25N.C6H11NO4/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11;7-4(3-6(10)11)1-2-5(8)9/h11-13H,1-10,14H2;4H,1-3,7H2,(H,8,9)(H,10,11) |
| InChIKey | FQXNDTXLICVCDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |