C16H11BrO — CID 23051119
(2E,10Z)-14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol (PubChem CID 23051119) has the molecular formula C16H11BrO and a molecular weight of 299.17 g/mol. Its IUPAC name is (2E,10Z)-14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol.
| Compound Name | (2E,10Z)-14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol |
|---|---|
| PubChem CID | 23051119 |
| Molecular Formula | C16H11BrO |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | (2E,10Z)-14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol |
| SMILES | O/C1=C/c2ccccc2/C=C\c2cc(Br)ccc21 |
| InChI | InChI=1S/C16H11BrO/c17-14-7-8-15-13(9-14)6-5-11-3-1-2-4-12(11)10-16(15)18/h1-10,18H/b6-5-,11-5-,12-10-,13-6-,16-10+,16-15+ |
| InChIKey | QZJUXIMOYLHDHW-ZRTUTITHSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|