C19H19NO3 — CID 23051151
(17-hydroxy-10-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaen-1-yl) acetate (PubChem CID 23051151) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (17-hydroxy-10-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaen-1-yl) acetate.
| Compound Name | (17-hydroxy-10-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaen-1-yl) acetate |
|---|---|
| PubChem CID | 23051151 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (17-hydroxy-10-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaen-1-yl) acetate |
| SMILES | CC(=O)OC12Cc3ccccc3CC(C)(c3ccccc31)N2O |
| InChI | InChI=1S/C19H19NO3/c1-13(21)23-19-12-15-8-4-3-7-14(15)11-18(2,20(19)22)16-9-5-6-10-17(16)19/h3-10,22H,11-12H2,1-2H3 |
| InChIKey | OCVXGYIGEOCTDI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |