C18H19N — CID 23051196
1,14-dimethyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene (PubChem CID 23051196) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 1,14-dimethyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene.
| Compound Name | 1,14-dimethyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 23051196 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1,14-dimethyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene |
| SMILES | Cc1ccc2c(c1)C1(C)Cc3ccccc3CC2N1 |
| InChI | InChI=1S/C18H19N/c1-12-7-8-15-16(9-12)18(2)11-14-6-4-3-5-13(14)10-17(15)19-18/h3-9,17,19H,10-11H2,1-2H3 |
| InChIKey | RTUYZSHHQINUBE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |