C32H35N4O3P — CID 2305131
N-phenyl-1-[phenylcarbamoyl-[(5S,7R)-3-[(phenylcarbamoylamino)methyl]-1-adamantyl]phosphanyl]formamide (PubChem CID 2305131) has the molecular formula C32H35N4O3P and a molecular weight of 554.63 g/mol. Its IUPAC name is N-phenyl-1-[phenylcarbamoyl-[(5S,7R)-3-[(phenylcarbamoylamino)methyl]-1-adamantyl]phosphanyl]formamide.
| Compound Name | N-phenyl-1-[phenylcarbamoyl-[(5S,7R)-3-[(phenylcarbamoylamino)methyl]-1-adamantyl]phosphanyl]formamide |
|---|---|
| PubChem CID | 2305131 |
| Molecular Formula | C32H35N4O3P |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | N-phenyl-1-[phenylcarbamoyl-[(5S,7R)-3-[(phenylcarbamoylamino)methyl]-1-adamantyl]phosphanyl]formamide |
| SMILES | O=C(NCC12C[C@H]3C[C@@H](C1)CC(P(C(=O)Nc1ccccc1)C(=O)Nc1ccccc1)(C3)C2)Nc1ccccc1 |
| InChI | InChI=1S/C32H35N4O3P/c37-28(34-25-10-4-1-5-11-25)33-22-31-17-23-16-24(18-31)20-32(19-23,21-31)40(29(38)35-26-12-6-2-7-13-26)30(39)36-27-14-8-3-9-15-27/h1-15,23-24H,16-22H2,(H,35,38)(H,36,39)(H2,33,34,37)/t23-,24+,31?,32? |
| InChIKey | SUKYJIVRHVJJCQ-VRFOEYDBSA-N |
| XLogP | 8.09 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|