About N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide
N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide (PubChem CID 23051630) has the molecular formula C33H32Br2N2O
and a molecular weight of 632.44 g/mol. Its IUPAC name is N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide.
Molecular Properties
| Compound Name | N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide |
| PubChem CID | 23051630 |
| Molecular Formula | C33H32Br2N2O |
| Molecular Weight | 632.44 g/mol |
| Exact Mass | 630.09 |
| IUPAC Name | N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide |
| SMILES | O=C(c1ccccc1)N(CCCC=C(c1ccc(Br)cc1)c1ccc(Br)cc1)CCCCc1cccnc1 |
| InChI | InChI=1S/C33H32Br2N2O/c34-30-18-14-27(15-19-30)32(28-16-20-31(35)21-17-28)13-5-7-24-37(33(38)29-11-2-1-3-12-29)23-6-4-9-26-10-8-22-36-25-26/h1-3,8,10-22,25H,4-7,9,23-24H2 |
| InChIKey | BFIJSUZQZOVVMG-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 632.44 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide?
The IUPAC name of N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide (CID 23051630) is N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide.
What is the SMILES notation for N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide?
The canonical SMILES for N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide is O=C(c1ccccc1)N(CCCC=C(c1ccc(Br)cc1)c1ccc(Br)cc1)CCCCc1cccnc1.
What is the InChIKey of N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide?
The InChIKey is BFIJSUZQZOVVMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H32Br2N2O/c34-30-18-14-27(15-19-30)32(28-16-20-31(35)21-17-28)13-5-7-24-37(33(38)29-11-2-1-3-12-29)23-6-4-9-26-10-8-22-36-25-26/h1-3,8,10-22,25H,4-7,9,23-24H2.
What are the key properties of N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide?
N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide has a molecular weight of 632.44 g/mol, XLogP of 8.98, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5,5-bis(4-bromophenyl)pent-4-enyl]-N-(4-pyridin-3-ylbutyl)benzamide is sourced from PubChem (CID 23051630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).