C22H38N2O4 — CID 23051746
3-[[bis(oxiran-2-ylmethyl)amino]methyl]-3,5,5-trimethyl-N,N-bis(oxiran-2-ylmethyl)cyclohexan-1-amine (PubChem CID 23051746) has the molecular formula C22H38N2O4 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-[[bis(oxiran-2-ylmethyl)amino]methyl]-3,5,5-trimethyl-N,N-bis(oxiran-2-ylmethyl)cyclohexan-1-amine.
| Compound Name | 3-[[bis(oxiran-2-ylmethyl)amino]methyl]-3,5,5-trimethyl-N,N-bis(oxiran-2-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 23051746 |
| Molecular Formula | C22H38N2O4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 3-[[bis(oxiran-2-ylmethyl)amino]methyl]-3,5,5-trimethyl-N,N-bis(oxiran-2-ylmethyl)cyclohexan-1-amine |
| SMILES | CC1(C)CC(N(CC2CO2)CC2CO2)CC(C)(CN(CC2CO2)CC2CO2)C1 |
| InChI | InChI=1S/C22H38N2O4/c1-21(2)4-16(24(8-19-12-27-19)9-20-13-28-20)5-22(3,14-21)15-23(6-17-10-25-17)7-18-11-26-18/h16-20H,4-15H2,1-3H3 |
| InChIKey | OCBRTNDWHKQGQW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|