About 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione
3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione (PubChem CID 23051905) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione |
| PubChem CID | 23051905 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(NCCCOc2cccc(C3OCCO3)c2)c(=O)c1=O |
| InChI | InChI=1S/C16H18N2O5/c17-12-13(15(20)14(12)19)18-5-2-6-21-11-4-1-3-10(9-11)16-22-7-8-23-16/h1,3-4,9,16,18H,2,5-8,17H2 |
| InChIKey | JMGZALFFVQWXGH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione (CID 23051905) is 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione is Nc1c(NCCCOc2cccc(C3OCCO3)c2)c(=O)c1=O.
What is the InChIKey of 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione?
The InChIKey is JMGZALFFVQWXGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5/c17-12-13(15(20)14(12)19)18-5-2-6-21-11-4-1-3-10(9-11)16-22-7-8-23-16/h1,3-4,9,16,18H,2,5-8,17H2.
What are the key properties of 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione?
3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione has a molecular weight of 318.33 g/mol, XLogP of 0.79, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[3-[3-(1,3-dioxolan-2-yl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 23051905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).