About 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride
2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride (PubChem CID 23052256) has the molecular formula C24H36Cl2N2O2
and a molecular weight of 455.47 g/mol. Its IUPAC name is 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride.
Molecular Properties
| Compound Name | 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride |
| PubChem CID | 23052256 |
| Molecular Formula | C24H36Cl2N2O2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride |
| SMILES | CC1CCCC1NCc1ccc2c(CNC3CCCC3C)c(O)ccc2c1O.Cl.Cl |
| InChI | InChI=1S/C24H34N2O2.2ClH/c1-15-5-3-7-21(15)25-13-17-9-10-18-19(24(17)28)11-12-23(27)20(18)14-26-22-8-4-6-16(22)2;;/h9-12,15-16,21-22,25-28H,3-8,13-14H2,1-2H3;2*1H |
| InChIKey | DERMZVBTNNZZFV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride?
The IUPAC name of 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride (CID 23052256) is 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride.
What is the SMILES notation for 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride?
The canonical SMILES for 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride is CC1CCCC1NCc1ccc2c(CNC3CCCC3C)c(O)ccc2c1O.Cl.Cl.
What is the InChIKey of 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride?
The InChIKey is DERMZVBTNNZZFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O2.2ClH/c1-15-5-3-7-21(15)25-13-17-9-10-18-19(24(17)28)11-12-23(27)20(18)14-26-22-8-4-6-16(22)2;;/h9-12,15-16,21-22,25-28H,3-8,13-14H2,1-2H3;2*1H.
What are the key properties of 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride?
2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride has a molecular weight of 455.47 g/mol, XLogP of 5.65, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[[(2-methylcyclopentyl)amino]methyl]naphthalene-1,6-diol;dihydrochloride is sourced from PubChem (CID 23052256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).