About 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide
2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 2305255) has the molecular formula C9H6F6N2O
and a molecular weight of 272.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide |
| PubChem CID | 2305255 |
| Molecular Formula | C9H6F6N2O |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H6F6N2O/c10-8(11,12)5-2-1-3-6(4-5)16-17-7(18)9(13,14)15/h1-4,16H,(H,17,18) |
| InChIKey | NXUYIVMZIHRQJH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide?
The IUPAC name of 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide (CID 2305255) is 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide.
What is the SMILES notation for 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide?
The canonical SMILES for 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide is O=C(NNc1cccc(C(F)(F)F)c1)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide?
The InChIKey is NXUYIVMZIHRQJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F6N2O/c10-8(11,12)5-2-1-3-6(4-5)16-17-7(18)9(13,14)15/h1-4,16H,(H,17,18).
What are the key properties of 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide?
2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide has a molecular weight of 272.15 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N'-[3-(trifluoromethyl)phenyl]acetohydrazide is sourced from PubChem (CID 2305255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).