C12H15NO — CID 23052682
1-(3,4-dimethylphenyl)pyrrolidin-3-one (PubChem CID 23052682) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)pyrrolidin-3-one.
| Compound Name | 1-(3,4-dimethylphenyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 23052682 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)pyrrolidin-3-one |
| SMILES | Cc1ccc(N2CCC(=O)C2)cc1C |
| InChI | InChI=1S/C12H15NO/c1-9-3-4-11(7-10(9)2)13-6-5-12(14)8-13/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | HTFLNIRHOZIGRF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|