C15H15N3 — CID 23052853
2-[1-(2,4-dimethylphenyl)pyrrolidin-3-ylidene]propanedinitrile (PubChem CID 23052853) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[1-(2,4-dimethylphenyl)pyrrolidin-3-ylidene]propanedinitrile.
| Compound Name | 2-[1-(2,4-dimethylphenyl)pyrrolidin-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 23052853 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-[1-(2,4-dimethylphenyl)pyrrolidin-3-ylidene]propanedinitrile |
| SMILES | Cc1ccc(N2CCC(=C(C#N)C#N)C2)c(C)c1 |
| InChI | InChI=1S/C15H15N3/c1-11-3-4-15(12(2)7-11)18-6-5-13(10-18)14(8-16)9-17/h3-4,7H,5-6,10H2,1-2H3 |
| InChIKey | KGKNRTBJKVBBDR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|