About (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine
(1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine (PubChem CID 23053107) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine.
Analyze (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine?
The IUPAC name of (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine (CID 23053107) is (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine.
What is the SMILES notation for (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine?
The canonical SMILES for (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine is CN(C)/C=C1\CCNC1.
What is the InChIKey of (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine?
The InChIKey is PPTUSCSOAIUCMZ-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H14N2/c1-9(2)6-7-3-4-8-5-7/h6,8H,3-5H2,1-2H3/b7-6+.
What are the key properties of (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine?
(1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine has a molecular weight of 126.20 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N,N-dimethyl-1-pyrrolidin-3-ylidenemethanamine is sourced from PubChem (CID 23053107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).