About 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one
7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one (PubChem CID 2305317) has the molecular formula C6H4BrN3O
and a molecular weight of 214.02 g/mol. Its IUPAC name is 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one |
| PubChem CID | 2305317 |
| Molecular Formula | C6H4BrN3O |
| Molecular Weight | 214.02 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one |
| SMILES | O=c1[nH]cc(Br)c2nc[nH]c12 |
| InChI | InChI=1S/C6H4BrN3O/c7-3-1-8-6(11)5-4(3)9-2-10-5/h1-2H,(H,8,11)(H,9,10) |
| InChIKey | ZYZOSWDYDRRXPZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.02 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
The IUPAC name of 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one (CID 2305317) is 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one.
What is the SMILES notation for 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
The canonical SMILES for 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one is O=c1[nH]cc(Br)c2nc[nH]c12.
What is the InChIKey of 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
The InChIKey is ZYZOSWDYDRRXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O/c7-3-1-8-6(11)5-4(3)9-2-10-5/h1-2H,(H,8,11)(H,9,10).
What are the key properties of 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one has a molecular weight of 214.02 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3,5-dihydroimidazo[4,5-c]pyridin-4-one is sourced from PubChem (CID 2305317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).