C11H16N2OS — CID 23053811
5,7-dimethyl-3-prop-2-enoxy-6,7-dihydro-4H-[1,2]thiazolo[4,5-c]pyridine (PubChem CID 23053811) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 5,7-dimethyl-3-prop-2-enoxy-6,7-dihydro-4H-[1,2]thiazolo[4,5-c]pyridine.
| Compound Name | 5,7-dimethyl-3-prop-2-enoxy-6,7-dihydro-4H-[1,2]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 23053811 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5,7-dimethyl-3-prop-2-enoxy-6,7-dihydro-4H-[1,2]thiazolo[4,5-c]pyridine |
| SMILES | C=CCOc1nsc2c1CN(C)CC2C |
| InChI | InChI=1S/C11H16N2OS/c1-4-5-14-11-9-7-13(3)6-8(2)10(9)15-12-11/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | VXXRVPOIKCNUSF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|