C23H12F9IO5S — CID 23054121
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium (PubChem CID 23054121) has the molecular formula C23H12F9IO5S and a molecular weight of 698.30 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium |
|---|---|
| PubChem CID | 23054121 |
| Molecular Formula | C23H12F9IO5S |
| Molecular Weight | 698.30 g/mol |
| Exact Mass | 697.93 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=c1c2ccccc2oc2ccc([I+]c3ccccc3)cc12 |
| InChI | InChI=1S/C19H12IO2.C4HF9O3S/c21-19-15-8-4-5-9-17(15)22-18-11-10-14(12-16(18)19)20-13-6-2-1-3-7-13;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-12H;(H,14,15,16)/q+1;/p-1 |
| InChIKey | FWRKPIPYXRJDIW-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 87.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|