2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid

C4HI7O2 — CID 23054133

IUPAC2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid
SMILESO=C(O)C(I)(C(I)(I)I)C(I)(I)I
InChIInChI=1S/C4HI7O2/c5-2(1(12)13,3(6,7)8)4(9,10)11/h(H,12,13)
InChIKeyPUDIHVGPTMFFJU-UHFFFAOYSA-N
MW969.38 g/mol
LogP5.16
Rot. Bonds3

About 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid

2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid (PubChem CID 23054133) has the molecular formula C4HI7O2 and a molecular weight of 969.38 g/mol. Its IUPAC name is 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid.

Molecular Properties

Compound Name2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid
PubChem CID23054133
Molecular FormulaC4HI7O2
Molecular Weight969.38 g/mol
Exact Mass969.33
IUPAC Name2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid
SMILESO=C(O)C(I)(C(I)(I)I)C(I)(I)I
InChIInChI=1S/C4HI7O2/c5-2(1(12)13,3(6,7)8)4(9,10)11/h(H,12,13)
InChIKeyPUDIHVGPTMFFJU-UHFFFAOYSA-N
XLogP5.16
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500969.38
LogP ≤ 55.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid?
The IUPAC name of 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid (CID 23054133) is 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid.
What is the SMILES notation for 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid?
The canonical SMILES for 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid is O=C(O)C(I)(C(I)(I)I)C(I)(I)I.
What is the InChIKey of 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid?
The InChIKey is PUDIHVGPTMFFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HI7O2/c5-2(1(12)13,3(6,7)8)4(9,10)11/h(H,12,13).
What are the key properties of 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid?
2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid has a molecular weight of 969.38 g/mol, XLogP of 5.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3,3-tetraiodo-2-(triiodomethyl)propanoic acid is sourced from PubChem (CID 23054133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).