C27H12F17IO5S — CID 23054146
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium (PubChem CID 23054146) has the molecular formula C27H12F17IO5S and a molecular weight of 898.32 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium |
|---|---|
| PubChem CID | 23054146 |
| Molecular Formula | C27H12F17IO5S |
| Molecular Weight | 898.32 g/mol |
| Exact Mass | 897.92 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;(9-oxoxanthen-2-yl)-phenyliodanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=c1c2ccccc2oc2ccc([I+]c3ccccc3)cc12 |
| InChI | InChI=1S/C19H12IO2.C8HF17O3S/c21-19-15-8-4-5-9-17(15)22-18-11-10-14(12-16(18)19)20-13-6-2-1-3-7-13;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h1-12H;(H,26,27,28)/q+1;/p-1 |
| InChIKey | WWSDRKTZXVVUIF-UHFFFAOYSA-M |
| XLogP | 5.57 |
| TPSA | 87.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|