C29H16F3IO7S — CID 23054318
(2-oxochromen-7-yl)-(9-oxoxanthen-2-yl)iodanium;4-(trifluoromethyl)benzenesulfonate (PubChem CID 23054318) has the molecular formula C29H16F3IO7S and a molecular weight of 692.41 g/mol. Its IUPAC name is (2-oxochromen-7-yl)-(9-oxoxanthen-2-yl)iodanium;4-(trifluoromethyl)benzenesulfonate.
| Compound Name | (2-oxochromen-7-yl)-(9-oxoxanthen-2-yl)iodanium;4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 23054318 |
| Molecular Formula | C29H16F3IO7S |
| Molecular Weight | 692.41 g/mol |
| Exact Mass | 691.96 |
| IUPAC Name | (2-oxochromen-7-yl)-(9-oxoxanthen-2-yl)iodanium;4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C(F)(F)F)cc1.O=c1ccc2ccc([I+]c3ccc4oc5ccccc5c(=O)c4c3)cc2o1 |
| InChI | InChI=1S/C22H12IO4.C7H5F3O3S/c24-21-10-6-13-5-7-15(12-20(13)27-21)23-14-8-9-19-17(11-14)22(25)16-3-1-2-4-18(16)26-19;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h1-12H;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | QUXMBZGRARAVRF-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 117.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|