About 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol
1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol (PubChem CID 23054353) has the molecular formula C24H22O4
and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol.
Molecular Properties
| Compound Name | 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol |
| PubChem CID | 23054353 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol |
| SMILES | CCC(C)(c1c(O)ccc2ccc(O)cc12)c1c(O)ccc2ccc(O)cc12 |
| InChI | InChI=1S/C24H22O4/c1-3-24(2,22-18-12-16(25)8-4-14(18)6-10-20(22)27)23-19-13-17(26)9-5-15(19)7-11-21(23)28/h4-13,25-28H,3H2,1-2H3 |
| InChIKey | JLZXKBAAZAYUQT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol?
The IUPAC name of 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol (CID 23054353) is 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol.
What is the SMILES notation for 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol?
The canonical SMILES for 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol is CCC(C)(c1c(O)ccc2ccc(O)cc12)c1c(O)ccc2ccc(O)cc12.
What is the InChIKey of 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol?
The InChIKey is JLZXKBAAZAYUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O4/c1-3-24(2,22-18-12-16(25)8-4-14(18)6-10-20(22)27)23-19-13-17(26)9-5-15(19)7-11-21(23)28/h4-13,25-28H,3H2,1-2H3.
What are the key properties of 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol?
1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol has a molecular weight of 374.44 g/mol, XLogP of 5.53, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,7-dihydroxynaphthalen-1-yl)butan-2-yl]naphthalene-2,7-diol is sourced from PubChem (CID 23054353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).