C14H8O7 — CID 23056177
1,2,3,4,5-pentahydroxyanthracene-9,10-dione (PubChem CID 23056177) has the molecular formula C14H8O7 and a molecular weight of 288.21 g/mol. Its IUPAC name is 1,2,3,4,5-pentahydroxyanthracene-9,10-dione.
| Compound Name | 1,2,3,4,5-pentahydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 23056177 |
| Molecular Formula | C14H8O7 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1,2,3,4,5-pentahydroxyanthracene-9,10-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)c(O)c(O)c(O)c21 |
| InChI | InChI=1S/C14H8O7/c15-5-3-1-2-4-6(5)10(17)8-7(9(4)16)11(18)13(20)14(21)12(8)19/h1-3,15,18-21H |
| InChIKey | KAIBLMMCFUZWGF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|