C12H17N3O5 — CID 23056719
3-ethyl-5-(3-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid (PubChem CID 23056719) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-ethyl-5-(3-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid.
| Compound Name | 3-ethyl-5-(3-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid |
|---|---|
| PubChem CID | 23056719 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-ethyl-5-(3-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid |
| SMILES | CCc1noc(C2=CC(C)CNC2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H15N3O.C2H2O4/c1-3-9-12-10(14-13-9)8-4-7(2)5-11-6-8;3-1(4)2(5)6/h4,7,11H,3,5-6H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MAQPYBVEAWXTJS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|