About 5-bromo-N,3-dimethylthiophen-2-amine
5-bromo-N,3-dimethylthiophen-2-amine (PubChem CID 23057079) has the molecular formula C6H8BrNS
and a molecular weight of 206.11 g/mol. Its IUPAC name is 5-bromo-N,3-dimethylthiophen-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N,3-dimethylthiophen-2-amine |
| PubChem CID | 23057079 |
| Molecular Formula | C6H8BrNS |
| Molecular Weight | 206.11 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | 5-bromo-N,3-dimethylthiophen-2-amine |
| SMILES | CNc1sc(Br)cc1C |
| InChI | InChI=1S/C6H8BrNS/c1-4-3-5(7)9-6(4)8-2/h3,8H,1-2H3 |
| InChIKey | OOCNKMAUKJGNQN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.11 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N,3-dimethylthiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,3-dimethylthiophen-2-amine?
The IUPAC name of 5-bromo-N,3-dimethylthiophen-2-amine (CID 23057079) is 5-bromo-N,3-dimethylthiophen-2-amine.
What is the SMILES notation for 5-bromo-N,3-dimethylthiophen-2-amine?
The canonical SMILES for 5-bromo-N,3-dimethylthiophen-2-amine is CNc1sc(Br)cc1C.
What is the InChIKey of 5-bromo-N,3-dimethylthiophen-2-amine?
The InChIKey is OOCNKMAUKJGNQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrNS/c1-4-3-5(7)9-6(4)8-2/h3,8H,1-2H3.
What are the key properties of 5-bromo-N,3-dimethylthiophen-2-amine?
5-bromo-N,3-dimethylthiophen-2-amine has a molecular weight of 206.11 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,3-dimethylthiophen-2-amine is sourced from PubChem (CID 23057079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).