C14H15NO10S2 — CID 2305801
dimethyl (4S,6R)-5-(4-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate (PubChem CID 2305801) has the molecular formula C14H15NO10S2 and a molecular weight of 421.41 g/mol. Its IUPAC name is dimethyl (4S,6R)-5-(4-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate.
| Compound Name | dimethyl (4S,6R)-5-(4-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 2305801 |
| Molecular Formula | C14H15NO10S2 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | dimethyl (4S,6R)-5-(4-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(c2ccc([N+](=O)[O-])cc2)[C@H](C(=O)OC)S(=O)(=O)CS1(=O)=O |
| InChI | InChI=1S/C14H15NO10S2/c1-24-13(16)11-10(8-3-5-9(6-4-8)15(18)19)12(14(17)25-2)27(22,23)7-26(11,20)21/h3-6,10-12H,7H2,1-2H3/t10?,11-,12+ |
| InChIKey | CAFCFRPXPDGJNG-YOGCLGLASA-N |
| XLogP | -0.44 |
| TPSA | 164.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|