About 2-methoxy-3-methylfuran
2-methoxy-3-methylfuran (PubChem CID 23058060) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is 2-methoxy-3-methylfuran.
Molecular Properties
| Compound Name | 2-methoxy-3-methylfuran |
| PubChem CID | 23058060 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 2-methoxy-3-methylfuran |
| SMILES | COc1occc1C |
| InChI | InChI=1S/C6H8O2/c1-5-3-4-8-6(5)7-2/h3-4H,1-2H3 |
| InChIKey | GRPOUZJEAJCTJZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-3-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-methylfuran?
The IUPAC name of 2-methoxy-3-methylfuran (CID 23058060) is 2-methoxy-3-methylfuran.
What is the SMILES notation for 2-methoxy-3-methylfuran?
The canonical SMILES for 2-methoxy-3-methylfuran is COc1occc1C.
What is the InChIKey of 2-methoxy-3-methylfuran?
The InChIKey is GRPOUZJEAJCTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-5-3-4-8-6(5)7-2/h3-4H,1-2H3.
What are the key properties of 2-methoxy-3-methylfuran?
2-methoxy-3-methylfuran has a molecular weight of 112.13 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-methylfuran is sourced from PubChem (CID 23058060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).