C24H18ClNO4 — CID 23060895
2-benzyl-6-chloro-4-[3-(hydroxymethyl)phenyl]-1-oxoisoquinoline-3-carboxylic acid (PubChem CID 23060895) has the molecular formula C24H18ClNO4 and a molecular weight of 419.86 g/mol. Its IUPAC name is 2-benzyl-6-chloro-4-[3-(hydroxymethyl)phenyl]-1-oxoisoquinoline-3-carboxylic acid.
| Compound Name | 2-benzyl-6-chloro-4-[3-(hydroxymethyl)phenyl]-1-oxoisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23060895 |
| Molecular Formula | C24H18ClNO4 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-benzyl-6-chloro-4-[3-(hydroxymethyl)phenyl]-1-oxoisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2cccc(CO)c2)c2cc(Cl)ccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H18ClNO4/c25-18-9-10-19-20(12-18)21(17-8-4-7-16(11-17)14-27)22(24(29)30)26(23(19)28)13-15-5-2-1-3-6-15/h1-12,27H,13-14H2,(H,29,30) |
| InChIKey | SDYFMPHIDBENCN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |